C25H16F3NO3 — CID 85226519
1-hydroxy-17-[4-(trifluoromethyl)phenyl]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 85226519) has the molecular formula C25H16F3NO3 and a molecular weight of 435.40 g/mol. Its IUPAC name is 1-hydroxy-17-[4-(trifluoromethyl)phenyl]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | 1-hydroxy-17-[4-(trifluoromethyl)phenyl]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 85226519 |
| Molecular Formula | C25H16F3NO3 |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 1-hydroxy-17-[4-(trifluoromethyl)phenyl]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | O=C1C2C3c4ccccc4C(O)(c4ccccc43)C2C(=O)N1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H16F3NO3/c26-25(27,28)13-9-11-14(12-10-13)29-22(30)20-19-15-5-1-3-7-17(15)24(32,21(20)23(29)31)18-8-4-2-6-16(18)19/h1-12,19-21,32H |
| InChIKey | PLUFDMRJNICDHO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|