C11H20O6 — CID 85231132
3-methyl-5-[6-(1,2,4-trioxolan-3-yl)hexyl]-1,2,4-trioxolane (PubChem CID 85231132) has the molecular formula C11H20O6 and a molecular weight of 248.27 g/mol. Its IUPAC name is 3-methyl-5-[6-(1,2,4-trioxolan-3-yl)hexyl]-1,2,4-trioxolane.
| Compound Name | 3-methyl-5-[6-(1,2,4-trioxolan-3-yl)hexyl]-1,2,4-trioxolane |
|---|---|
| PubChem CID | 85231132 |
| Molecular Formula | C11H20O6 |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 3-methyl-5-[6-(1,2,4-trioxolan-3-yl)hexyl]-1,2,4-trioxolane |
| SMILES | CC1OOC(CCCCCCC2OCOO2)O1 |
| InChI | InChI=1S/C11H20O6/c1-9-14-11(17-15-9)7-5-3-2-4-6-10-12-8-13-16-10/h9-11H,2-8H2,1H3 |
| InChIKey | BKIBYORQSLQCFU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|