About N-(3-phenyl-1,2,4-thiadiazol-5-yl)acetamide
N-(3-phenyl-1,2,4-thiadiazol-5-yl)acetamide (PubChem CID 852344) has the molecular formula C10H9N3OS
and a molecular weight of 219.27 g/mol. Its IUPAC name is N-(3-phenyl-1,2,4-thiadiazol-5-yl)acetamide.
Molecular Properties
| Compound Name | N-(3-phenyl-1,2,4-thiadiazol-5-yl)acetamide |
| PubChem CID | 852344 |
| Molecular Formula | C10H9N3OS |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | N-(3-phenyl-1,2,4-thiadiazol-5-yl)acetamide |
| SMILES | CC(=O)Nc1nc(-c2ccccc2)ns1 |
| InChI | InChI=1S/C10H9N3OS/c1-7(14)11-10-12-9(13-15-10)8-5-3-2-4-6-8/h2-6H,1H3,(H,11,12,13,14) |
| InChIKey | XIYDDBUZDPBBLE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-phenyl-1,2,4-thiadiazol-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-phenyl-1,2,4-thiadiazol-5-yl)acetamide?
The IUPAC name of N-(3-phenyl-1,2,4-thiadiazol-5-yl)acetamide (CID 852344) is N-(3-phenyl-1,2,4-thiadiazol-5-yl)acetamide.
What is the SMILES notation for N-(3-phenyl-1,2,4-thiadiazol-5-yl)acetamide?
The canonical SMILES for N-(3-phenyl-1,2,4-thiadiazol-5-yl)acetamide is CC(=O)Nc1nc(-c2ccccc2)ns1.
What is the InChIKey of N-(3-phenyl-1,2,4-thiadiazol-5-yl)acetamide?
The InChIKey is XIYDDBUZDPBBLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3OS/c1-7(14)11-10-12-9(13-15-10)8-5-3-2-4-6-8/h2-6H,1H3,(H,11,12,13,14).
What are the key properties of N-(3-phenyl-1,2,4-thiadiazol-5-yl)acetamide?
N-(3-phenyl-1,2,4-thiadiazol-5-yl)acetamide has a molecular weight of 219.27 g/mol, XLogP of 2.16, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-phenyl-1,2,4-thiadiazol-5-yl)acetamide is sourced from PubChem (CID 852344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).