About N-[4-(1-methylimidazo[2,1-a]isoquinolin-4-ium-2-yl)phenyl]acetamide
N-[4-(1-methylimidazo[2,1-a]isoquinolin-4-ium-2-yl)phenyl]acetamide (PubChem CID 852363) has the molecular formula C20H18N3O+
and a molecular weight of 316.38 g/mol. Its IUPAC name is N-[4-(1-methylimidazo[2,1-a]isoquinolin-4-ium-2-yl)phenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-(1-methylimidazo[2,1-a]isoquinolin-4-ium-2-yl)phenyl]acetamide |
| PubChem CID | 852363 |
| Molecular Formula | C20H18N3O+ |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | N-[4-(1-methylimidazo[2,1-a]isoquinolin-4-ium-2-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2c[n+]3ccc4ccccc4c3n2C)cc1 |
| InChI | InChI=1S/C20H17N3O/c1-14(24)21-17-9-7-16(8-10-17)19-13-23-12-11-15-5-3-4-6-18(15)20(23)22(19)2/h3-13H,1-2H3/p+1 |
| InChIKey | MHIFLYYZXJCWRX-UHFFFAOYSA-O |
| XLogP | 3.54 |
| TPSA | 38.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(1-methylimidazo[2,1-a]isoquinolin-4-ium-2-yl)phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(1-methylimidazo[2,1-a]isoquinolin-4-ium-2-yl)phenyl]acetamide?
The IUPAC name of N-[4-(1-methylimidazo[2,1-a]isoquinolin-4-ium-2-yl)phenyl]acetamide (CID 852363) is N-[4-(1-methylimidazo[2,1-a]isoquinolin-4-ium-2-yl)phenyl]acetamide.
What is the SMILES notation for N-[4-(1-methylimidazo[2,1-a]isoquinolin-4-ium-2-yl)phenyl]acetamide?
The canonical SMILES for N-[4-(1-methylimidazo[2,1-a]isoquinolin-4-ium-2-yl)phenyl]acetamide is CC(=O)Nc1ccc(-c2c[n+]3ccc4ccccc4c3n2C)cc1.
What is the InChIKey of N-[4-(1-methylimidazo[2,1-a]isoquinolin-4-ium-2-yl)phenyl]acetamide?
The InChIKey is MHIFLYYZXJCWRX-UHFFFAOYSA-O. The full InChI is InChI=1S/C20H17N3O/c1-14(24)21-17-9-7-16(8-10-17)19-13-23-12-11-15-5-3-4-6-18(15)20(23)22(19)2/h3-13H,1-2H3/p+1.
What are the key properties of N-[4-(1-methylimidazo[2,1-a]isoquinolin-4-ium-2-yl)phenyl]acetamide?
N-[4-(1-methylimidazo[2,1-a]isoquinolin-4-ium-2-yl)phenyl]acetamide has a molecular weight of 316.38 g/mol, XLogP of 3.54, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(1-methylimidazo[2,1-a]isoquinolin-4-ium-2-yl)phenyl]acetamide is sourced from PubChem (CID 852363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).