C36H62O10 — CID 85237398
2-[[17-(2,5-dihydroxy-6-methylhept-6-en-2-yl)-1,2-dihydroxy-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 85237398) has the molecular formula C36H62O10 and a molecular weight of 654.88 g/mol. Its IUPAC name is 2-[[17-(2,5-dihydroxy-6-methylhept-6-en-2-yl)-1,2-dihydroxy-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-[[17-(2,5-dihydroxy-6-methylhept-6-en-2-yl)-1,2-dihydroxy-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 85237398 |
| Molecular Formula | C36H62O10 |
| Molecular Weight | 654.88 g/mol |
| Exact Mass | 654.43 |
| IUPAC Name | 2-[[17-(2,5-dihydroxy-6-methylhept-6-en-2-yl)-1,2-dihydroxy-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | C=C(C)C(O)CCC(C)(O)C1CCC2(C)C1CCC1C3(C)C(O)C(O)C(OC4OC(CO)C(O)C(O)C4O)C(C)(C)C3CCC12C |
| InChI | InChI=1S/C36H62O10/c1-18(2)21(38)12-16-35(7,44)20-11-14-33(5)19(20)9-10-24-34(33,6)15-13-23-32(3,4)30(28(42)29(43)36(23,24)8)46-31-27(41)26(40)25(39)22(17-37)45-31/h19-31,37-44H,1,9-17H2,2-8H3 |
| InChIKey | MFYBZVKJMFAPNF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 180.30 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.88 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|