About 2-imidazol-1-ylethyl N,N-dimethylcarbamate
2-imidazol-1-ylethyl N,N-dimethylcarbamate (PubChem CID 852442) has the molecular formula C8H13N3O2
and a molecular weight of 183.21 g/mol. Its IUPAC name is 2-imidazol-1-ylethyl N,N-dimethylcarbamate.
Molecular Properties
| Compound Name | 2-imidazol-1-ylethyl N,N-dimethylcarbamate |
| PubChem CID | 852442 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 2-imidazol-1-ylethyl N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)OCCn1ccnc1 |
| InChI | InChI=1S/C8H13N3O2/c1-10(2)8(12)13-6-5-11-4-3-9-7-11/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | WSDMJRGHLMKKID-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-imidazol-1-ylethyl N,N-dimethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imidazol-1-ylethyl N,N-dimethylcarbamate?
The IUPAC name of 2-imidazol-1-ylethyl N,N-dimethylcarbamate (CID 852442) is 2-imidazol-1-ylethyl N,N-dimethylcarbamate.
What is the SMILES notation for 2-imidazol-1-ylethyl N,N-dimethylcarbamate?
The canonical SMILES for 2-imidazol-1-ylethyl N,N-dimethylcarbamate is CN(C)C(=O)OCCn1ccnc1.
What is the InChIKey of 2-imidazol-1-ylethyl N,N-dimethylcarbamate?
The InChIKey is WSDMJRGHLMKKID-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O2/c1-10(2)8(12)13-6-5-11-4-3-9-7-11/h3-4,7H,5-6H2,1-2H3.
What are the key properties of 2-imidazol-1-ylethyl N,N-dimethylcarbamate?
2-imidazol-1-ylethyl N,N-dimethylcarbamate has a molecular weight of 183.21 g/mol, XLogP of 0.58, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imidazol-1-ylethyl N,N-dimethylcarbamate is sourced from PubChem (CID 852442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).