About (1,2-dimethylimidazo[1,2-a]pyridin-4-ium-7-yl) N,N-dimethylcarbamate
(1,2-dimethylimidazo[1,2-a]pyridin-4-ium-7-yl) N,N-dimethylcarbamate (PubChem CID 852447) has the molecular formula C12H16N3O2+
and a molecular weight of 234.28 g/mol. Its IUPAC name is (1,2-dimethylimidazo[1,2-a]pyridin-4-ium-7-yl) N,N-dimethylcarbamate.
Molecular Properties
| Compound Name | (1,2-dimethylimidazo[1,2-a]pyridin-4-ium-7-yl) N,N-dimethylcarbamate |
| PubChem CID | 852447 |
| Molecular Formula | C12H16N3O2+ |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | (1,2-dimethylimidazo[1,2-a]pyridin-4-ium-7-yl) N,N-dimethylcarbamate |
| SMILES | Cc1c[n+]2ccc(OC(=O)N(C)C)cc2n1C |
| InChI | InChI=1S/C12H16N3O2/c1-9-8-15-6-5-10(7-11(15)14(9)4)17-12(16)13(2)3/h5-8H,1-4H3/q+1 |
| InChIKey | JNXPIRFPOMOZKU-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 38.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (1,2-dimethylimidazo[1,2-a]pyridin-4-ium-7-yl) N,N-dimethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,2-dimethylimidazo[1,2-a]pyridin-4-ium-7-yl) N,N-dimethylcarbamate?
The IUPAC name of (1,2-dimethylimidazo[1,2-a]pyridin-4-ium-7-yl) N,N-dimethylcarbamate (CID 852447) is (1,2-dimethylimidazo[1,2-a]pyridin-4-ium-7-yl) N,N-dimethylcarbamate.
What is the SMILES notation for (1,2-dimethylimidazo[1,2-a]pyridin-4-ium-7-yl) N,N-dimethylcarbamate?
The canonical SMILES for (1,2-dimethylimidazo[1,2-a]pyridin-4-ium-7-yl) N,N-dimethylcarbamate is Cc1c[n+]2ccc(OC(=O)N(C)C)cc2n1C.
What is the InChIKey of (1,2-dimethylimidazo[1,2-a]pyridin-4-ium-7-yl) N,N-dimethylcarbamate?
The InChIKey is JNXPIRFPOMOZKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N3O2/c1-9-8-15-6-5-10(7-11(15)14(9)4)17-12(16)13(2)3/h5-8H,1-4H3/q+1.
What are the key properties of (1,2-dimethylimidazo[1,2-a]pyridin-4-ium-7-yl) N,N-dimethylcarbamate?
(1,2-dimethylimidazo[1,2-a]pyridin-4-ium-7-yl) N,N-dimethylcarbamate has a molecular weight of 234.28 g/mol, XLogP of 1.13, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1,2-dimethylimidazo[1,2-a]pyridin-4-ium-7-yl) N,N-dimethylcarbamate is sourced from PubChem (CID 852447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).