About benzyl 2-(1,2-dihydroxyethyl)pyrrolidine-1-carboxylate
benzyl 2-(1,2-dihydroxyethyl)pyrrolidine-1-carboxylate (PubChem CID 85248335) has the molecular formula C14H19NO4
and a molecular weight of 265.31 g/mol. Its IUPAC name is benzyl 2-(1,2-dihydroxyethyl)pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | benzyl 2-(1,2-dihydroxyethyl)pyrrolidine-1-carboxylate |
| PubChem CID | 85248335 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | benzyl 2-(1,2-dihydroxyethyl)pyrrolidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCCC1C(O)CO |
| InChI | InChI=1S/C14H19NO4/c16-9-13(17)12-7-4-8-15(12)14(18)19-10-11-5-2-1-3-6-11/h1-3,5-6,12-13,16-17H,4,7-10H2 |
| InChIKey | ZTILVFSKVNXIEX-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzyl 2-(1,2-dihydroxyethyl)pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-(1,2-dihydroxyethyl)pyrrolidine-1-carboxylate?
The IUPAC name of benzyl 2-(1,2-dihydroxyethyl)pyrrolidine-1-carboxylate (CID 85248335) is benzyl 2-(1,2-dihydroxyethyl)pyrrolidine-1-carboxylate.
What is the SMILES notation for benzyl 2-(1,2-dihydroxyethyl)pyrrolidine-1-carboxylate?
The canonical SMILES for benzyl 2-(1,2-dihydroxyethyl)pyrrolidine-1-carboxylate is O=C(OCc1ccccc1)N1CCCC1C(O)CO.
What is the InChIKey of benzyl 2-(1,2-dihydroxyethyl)pyrrolidine-1-carboxylate?
The InChIKey is ZTILVFSKVNXIEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO4/c16-9-13(17)12-7-4-8-15(12)14(18)19-10-11-5-2-1-3-6-11/h1-3,5-6,12-13,16-17H,4,7-10H2.
What are the key properties of benzyl 2-(1,2-dihydroxyethyl)pyrrolidine-1-carboxylate?
benzyl 2-(1,2-dihydroxyethyl)pyrrolidine-1-carboxylate has a molecular weight of 265.31 g/mol, XLogP of 1.14, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-(1,2-dihydroxyethyl)pyrrolidine-1-carboxylate is sourced from PubChem (CID 85248335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).