benzyl 2-(1,2-dihydroxyethyl)pyrrolidine-1-carboxylate

C14H19NO4 — CID 85248335

IUPACbenzyl 2-(1,2-dihydroxyethyl)pyrrolidine-1-carboxylate
SMILESO=C(OCc1ccccc1)N1CCCC1C(O)CO
InChIInChI=1S/C14H19NO4/c16-9-13(17)12-7-4-8-15(12)14(18)19-10-11-5-2-1-3-6-11/h1-3,5-6,12-13,16-17H,4,7-10H2
InChIKeyZTILVFSKVNXIEX-UHFFFAOYSA-N
MW265.31 g/mol
LogP1.14
Rot. Bonds4

About benzyl 2-(1,2-dihydroxyethyl)pyrrolidine-1-carboxylate

benzyl 2-(1,2-dihydroxyethyl)pyrrolidine-1-carboxylate (PubChem CID 85248335) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is benzyl 2-(1,2-dihydroxyethyl)pyrrolidine-1-carboxylate.

Molecular Properties

Compound Namebenzyl 2-(1,2-dihydroxyethyl)pyrrolidine-1-carboxylate
PubChem CID85248335
Molecular FormulaC14H19NO4
Molecular Weight265.31 g/mol
Exact Mass265.13
IUPAC Namebenzyl 2-(1,2-dihydroxyethyl)pyrrolidine-1-carboxylate
SMILESO=C(OCc1ccccc1)N1CCCC1C(O)CO
InChIInChI=1S/C14H19NO4/c16-9-13(17)12-7-4-8-15(12)14(18)19-10-11-5-2-1-3-6-11/h1-3,5-6,12-13,16-17H,4,7-10H2
InChIKeyZTILVFSKVNXIEX-UHFFFAOYSA-N
XLogP1.14
TPSA70.00 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.31
LogP ≤ 51.14
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze benzyl 2-(1,2-dihydroxyethyl)pyrrolidine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 2-(1,2-dihydroxyethyl)pyrrolidine-1-carboxylate?
The IUPAC name of benzyl 2-(1,2-dihydroxyethyl)pyrrolidine-1-carboxylate (CID 85248335) is benzyl 2-(1,2-dihydroxyethyl)pyrrolidine-1-carboxylate.
What is the SMILES notation for benzyl 2-(1,2-dihydroxyethyl)pyrrolidine-1-carboxylate?
The canonical SMILES for benzyl 2-(1,2-dihydroxyethyl)pyrrolidine-1-carboxylate is O=C(OCc1ccccc1)N1CCCC1C(O)CO.
What is the InChIKey of benzyl 2-(1,2-dihydroxyethyl)pyrrolidine-1-carboxylate?
The InChIKey is ZTILVFSKVNXIEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO4/c16-9-13(17)12-7-4-8-15(12)14(18)19-10-11-5-2-1-3-6-11/h1-3,5-6,12-13,16-17H,4,7-10H2.
What are the key properties of benzyl 2-(1,2-dihydroxyethyl)pyrrolidine-1-carboxylate?
benzyl 2-(1,2-dihydroxyethyl)pyrrolidine-1-carboxylate has a molecular weight of 265.31 g/mol, XLogP of 1.14, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-(1,2-dihydroxyethyl)pyrrolidine-1-carboxylate is sourced from PubChem (CID 85248335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).