C20H24BrNO2 — CID 85250985
6-bromo-4,8b-bis(3-methylbut-2-enyl)-1,3a-dihydrofuro[2,3-b]indol-2-one (PubChem CID 85250985) has the molecular formula C20H24BrNO2 and a molecular weight of 390.32 g/mol. Its IUPAC name is 6-bromo-4,8b-bis(3-methylbut-2-enyl)-1,3a-dihydrofuro[2,3-b]indol-2-one.
| Compound Name | 6-bromo-4,8b-bis(3-methylbut-2-enyl)-1,3a-dihydrofuro[2,3-b]indol-2-one |
|---|---|
| PubChem CID | 85250985 |
| Molecular Formula | C20H24BrNO2 |
| Molecular Weight | 390.32 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 6-bromo-4,8b-bis(3-methylbut-2-enyl)-1,3a-dihydrofuro[2,3-b]indol-2-one |
| SMILES | CC(C)=CCN1c2cc(Br)ccc2C2(CC=C(C)C)CC(=O)OC12 |
| InChI | InChI=1S/C20H24BrNO2/c1-13(2)7-9-20-12-18(23)24-19(20)22(10-8-14(3)4)17-11-15(21)5-6-16(17)20/h5-8,11,19H,9-10,12H2,1-4H3 |
| InChIKey | HINYSXMMFNABML-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.32 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|