About spiro[1,3-dioxolane-2,5'-bicyclo[4.1.0]hept-3-ene]-2'-one
spiro[1,3-dioxolane-2,5'-bicyclo[4.1.0]hept-3-ene]-2'-one (PubChem CID 85255437) has the molecular formula C9H10O3
and a molecular weight of 166.18 g/mol. Its IUPAC name is spiro[1,3-dioxolane-2,5'-bicyclo[4.1.0]hept-3-ene]-2'-one.
Molecular Properties
| Compound Name | spiro[1,3-dioxolane-2,5'-bicyclo[4.1.0]hept-3-ene]-2'-one |
| PubChem CID | 85255437 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | spiro[1,3-dioxolane-2,5'-bicyclo[4.1.0]hept-3-ene]-2'-one |
| SMILES | O=C1C=CC2(OCCO2)C2CC12 |
| InChI | InChI=1S/C9H10O3/c10-8-1-2-9(7-5-6(7)8)11-3-4-12-9/h1-2,6-7H,3-5H2 |
| InChIKey | RLNSMSLAYCLPQQ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze spiro[1,3-dioxolane-2,5'-bicyclo[4.1.0]hept-3-ene]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,3-dioxolane-2,5'-bicyclo[4.1.0]hept-3-ene]-2'-one?
The IUPAC name of spiro[1,3-dioxolane-2,5'-bicyclo[4.1.0]hept-3-ene]-2'-one (CID 85255437) is spiro[1,3-dioxolane-2,5'-bicyclo[4.1.0]hept-3-ene]-2'-one.
What is the SMILES notation for spiro[1,3-dioxolane-2,5'-bicyclo[4.1.0]hept-3-ene]-2'-one?
The canonical SMILES for spiro[1,3-dioxolane-2,5'-bicyclo[4.1.0]hept-3-ene]-2'-one is O=C1C=CC2(OCCO2)C2CC12.
What is the InChIKey of spiro[1,3-dioxolane-2,5'-bicyclo[4.1.0]hept-3-ene]-2'-one?
The InChIKey is RLNSMSLAYCLPQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3/c10-8-1-2-9(7-5-6(7)8)11-3-4-12-9/h1-2,6-7H,3-5H2.
What are the key properties of spiro[1,3-dioxolane-2,5'-bicyclo[4.1.0]hept-3-ene]-2'-one?
spiro[1,3-dioxolane-2,5'-bicyclo[4.1.0]hept-3-ene]-2'-one has a molecular weight of 166.18 g/mol, XLogP of 0.50, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,3-dioxolane-2,5'-bicyclo[4.1.0]hept-3-ene]-2'-one is sourced from PubChem (CID 85255437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).