C25H42O2 — CID 85259021
1-(5-hydroxy-3-methylpent-3-enyl)-4b,8,8,10a-tetramethyl-2-methylidene-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-9-ol (PubChem CID 85259021) has the molecular formula C25H42O2 and a molecular weight of 374.61 g/mol. Its IUPAC name is 1-(5-hydroxy-3-methylpent-3-enyl)-4b,8,8,10a-tetramethyl-2-methylidene-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-9-ol.
| Compound Name | 1-(5-hydroxy-3-methylpent-3-enyl)-4b,8,8,10a-tetramethyl-2-methylidene-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-9-ol |
|---|---|
| PubChem CID | 85259021 |
| Molecular Formula | C25H42O2 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.32 |
| IUPAC Name | 1-(5-hydroxy-3-methylpent-3-enyl)-4b,8,8,10a-tetramethyl-2-methylidene-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-9-ol |
| SMILES | C=C1CCC2C(C)(CC(O)C3C(C)(C)CCCC32C)C1CCC(C)=CCO |
| InChI | InChI=1S/C25H42O2/c1-17(12-15-26)8-10-19-18(2)9-11-21-24(5)14-7-13-23(3,4)22(24)20(27)16-25(19,21)6/h12,19-22,26-27H,2,7-11,13-16H2,1,3-6H3 |
| InChIKey | WJTRDGPQMBTDGG-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|