C25H30O6 — CID 85260029
[3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2,2-dimethylpropyl] 7-hydroxy-2-methyl-6-methylideneoct-2-enoate (PubChem CID 85260029) has the molecular formula C25H30O6 and a molecular weight of 426.51 g/mol. Its IUPAC name is [3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2,2-dimethylpropyl] 7-hydroxy-2-methyl-6-methylideneoct-2-enoate.
| Compound Name | [3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2,2-dimethylpropyl] 7-hydroxy-2-methyl-6-methylideneoct-2-enoate |
|---|---|
| PubChem CID | 85260029 |
| Molecular Formula | C25H30O6 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | [3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2,2-dimethylpropyl] 7-hydroxy-2-methyl-6-methylideneoct-2-enoate |
| SMILES | C=C(CCC=C(C)C(=O)OCC(C)(C)CC1=C(O)c2ccccc2C(=O)C1=O)C(C)O |
| InChI | InChI=1S/C25H30O6/c1-15(17(3)26)9-8-10-16(2)24(30)31-14-25(4,5)13-20-21(27)18-11-6-7-12-19(18)22(28)23(20)29/h6-7,10-12,17,26-27H,1,8-9,13-14H2,2-5H3 |
| InChIKey | WSQAPTBHFZVTMV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|