C30H49N5O7 — CID 85261982
13,16-di(butan-2-yl)-10,11,14-trimethyl-3-prop-2-enyl-4-oxa-1,8,11,14,17-pentazabicyclo[17.3.0]docosane-2,5,9,12,15,18-hexone (PubChem CID 85261982) has the molecular formula C30H49N5O7 and a molecular weight of 591.75 g/mol. Its IUPAC name is 13,16-di(butan-2-yl)-10,11,14-trimethyl-3-prop-2-enyl-4-oxa-1,8,11,14,17-pentazabicyclo[17.3.0]docosane-2,5,9,12,15,18-hexone.
| Compound Name | 13,16-di(butan-2-yl)-10,11,14-trimethyl-3-prop-2-enyl-4-oxa-1,8,11,14,17-pentazabicyclo[17.3.0]docosane-2,5,9,12,15,18-hexone |
|---|---|
| PubChem CID | 85261982 |
| Molecular Formula | C30H49N5O7 |
| Molecular Weight | 591.75 g/mol |
| Exact Mass | 591.36 |
| IUPAC Name | 13,16-di(butan-2-yl)-10,11,14-trimethyl-3-prop-2-enyl-4-oxa-1,8,11,14,17-pentazabicyclo[17.3.0]docosane-2,5,9,12,15,18-hexone |
| SMILES | C=CCC1OC(=O)CCNC(=O)C(C)N(C)C(=O)C(C(C)CC)N(C)C(=O)C(C(C)CC)NC(=O)C2CCCN2C1=O |
| InChI | InChI=1S/C30H49N5O7/c1-9-13-22-28(39)35-17-12-14-21(35)27(38)32-24(18(4)10-2)29(40)34(8)25(19(5)11-3)30(41)33(7)20(6)26(37)31-16-15-23(36)42-22/h9,18-22,24-25H,1,10-17H2,2-8H3,(H,31,37)(H,32,38) |
| InChIKey | HLRYHDDTULAZQQ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 145.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.75 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|