C11H12N4OS2 — CID 852648
N-[(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]thiophene-2-carboxamide (PubChem CID 852648) has the molecular formula C11H12N4OS2 and a molecular weight of 280.38 g/mol. Its IUPAC name is N-[(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]thiophene-2-carboxamide.
| Compound Name | N-[(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 852648 |
| Molecular Formula | C11H12N4OS2 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | N-[(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]thiophene-2-carboxamide |
| SMILES | C=CCn1c(CNC(=O)c2cccs2)n[nH]c1=S |
| InChI | InChI=1S/C11H12N4OS2/c1-2-5-15-9(13-14-11(15)17)7-12-10(16)8-4-3-6-18-8/h2-4,6H,1,5,7H2,(H,12,16)(H,14,17) |
| InChIKey | BMUMTHYRKJJLOW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|