About 1,4-bis(benzylsulfanyl)butane-2,3-diol
1,4-bis(benzylsulfanyl)butane-2,3-diol (PubChem CID 85266337) has the molecular formula C18H22O2S2
and a molecular weight of 334.51 g/mol. Its IUPAC name is 1,4-bis(benzylsulfanyl)butane-2,3-diol.
Molecular Properties
| Compound Name | 1,4-bis(benzylsulfanyl)butane-2,3-diol |
| PubChem CID | 85266337 |
| Molecular Formula | C18H22O2S2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 1,4-bis(benzylsulfanyl)butane-2,3-diol |
| SMILES | OC(CSCc1ccccc1)C(O)CSCc1ccccc1 |
| InChI | InChI=1S/C18H22O2S2/c19-17(13-21-11-15-7-3-1-4-8-15)18(20)14-22-12-16-9-5-2-6-10-16/h1-10,17-20H,11-14H2 |
| InChIKey | URQMIGKXDWWLQH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,4-bis(benzylsulfanyl)butane-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis(benzylsulfanyl)butane-2,3-diol?
The IUPAC name of 1,4-bis(benzylsulfanyl)butane-2,3-diol (CID 85266337) is 1,4-bis(benzylsulfanyl)butane-2,3-diol.
What is the SMILES notation for 1,4-bis(benzylsulfanyl)butane-2,3-diol?
The canonical SMILES for 1,4-bis(benzylsulfanyl)butane-2,3-diol is OC(CSCc1ccccc1)C(O)CSCc1ccccc1.
What is the InChIKey of 1,4-bis(benzylsulfanyl)butane-2,3-diol?
The InChIKey is URQMIGKXDWWLQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22O2S2/c19-17(13-21-11-15-7-3-1-4-8-15)18(20)14-22-12-16-9-5-2-6-10-16/h1-10,17-20H,11-14H2.
What are the key properties of 1,4-bis(benzylsulfanyl)butane-2,3-diol?
1,4-bis(benzylsulfanyl)butane-2,3-diol has a molecular weight of 334.51 g/mol, XLogP of 3.58, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis(benzylsulfanyl)butane-2,3-diol is sourced from PubChem (CID 85266337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).