C16H30N2O6 — CID 85266590
7,14-dimethoxy-3,3,10,10-tetramethyl-1,8-dioxa-4,11-diazacyclotetradecane-5,12-dione (PubChem CID 85266590) has the molecular formula C16H30N2O6 and a molecular weight of 346.42 g/mol. Its IUPAC name is 7,14-dimethoxy-3,3,10,10-tetramethyl-1,8-dioxa-4,11-diazacyclotetradecane-5,12-dione.
| Compound Name | 7,14-dimethoxy-3,3,10,10-tetramethyl-1,8-dioxa-4,11-diazacyclotetradecane-5,12-dione |
|---|---|
| PubChem CID | 85266590 |
| Molecular Formula | C16H30N2O6 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 7,14-dimethoxy-3,3,10,10-tetramethyl-1,8-dioxa-4,11-diazacyclotetradecane-5,12-dione |
| SMILES | COC1CC(=O)NC(C)(C)COC(OC)CC(=O)NC(C)(C)CO1 |
| InChI | InChI=1S/C16H30N2O6/c1-15(2)9-23-13(21-5)8-12(20)18-16(3,4)10-24-14(22-6)7-11(19)17-15/h13-14H,7-10H2,1-6H3,(H,17,19)(H,18,20) |
| InChIKey | RZGKDICIKZBTGB-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |