About 1-[(3,6-dimethylpyrazin-2-yl)-methylamino]-3-phenylthiourea
1-[(3,6-dimethylpyrazin-2-yl)-methylamino]-3-phenylthiourea (PubChem CID 852690) has the molecular formula C14H17N5S
and a molecular weight of 287.39 g/mol. Its IUPAC name is 1-[(3,6-dimethylpyrazin-2-yl)-methylamino]-3-phenylthiourea.
Molecular Properties
| Compound Name | 1-[(3,6-dimethylpyrazin-2-yl)-methylamino]-3-phenylthiourea |
| PubChem CID | 852690 |
| Molecular Formula | C14H17N5S |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 1-[(3,6-dimethylpyrazin-2-yl)-methylamino]-3-phenylthiourea |
| SMILES | Cc1cnc(C)c(N(C)NC(=S)Nc2ccccc2)n1 |
| InChI | InChI=1S/C14H17N5S/c1-10-9-15-11(2)13(16-10)19(3)18-14(20)17-12-7-5-4-6-8-12/h4-9H,1-3H3,(H2,17,18,20) |
| InChIKey | YWOZYOCRBNFABL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3,6-dimethylpyrazin-2-yl)-methylamino]-3-phenylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,6-dimethylpyrazin-2-yl)-methylamino]-3-phenylthiourea?
The IUPAC name of 1-[(3,6-dimethylpyrazin-2-yl)-methylamino]-3-phenylthiourea (CID 852690) is 1-[(3,6-dimethylpyrazin-2-yl)-methylamino]-3-phenylthiourea.
What is the SMILES notation for 1-[(3,6-dimethylpyrazin-2-yl)-methylamino]-3-phenylthiourea?
The canonical SMILES for 1-[(3,6-dimethylpyrazin-2-yl)-methylamino]-3-phenylthiourea is Cc1cnc(C)c(N(C)NC(=S)Nc2ccccc2)n1.
What is the InChIKey of 1-[(3,6-dimethylpyrazin-2-yl)-methylamino]-3-phenylthiourea?
The InChIKey is YWOZYOCRBNFABL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N5S/c1-10-9-15-11(2)13(16-10)19(3)18-14(20)17-12-7-5-4-6-8-12/h4-9H,1-3H3,(H2,17,18,20).
What are the key properties of 1-[(3,6-dimethylpyrazin-2-yl)-methylamino]-3-phenylthiourea?
1-[(3,6-dimethylpyrazin-2-yl)-methylamino]-3-phenylthiourea has a molecular weight of 287.39 g/mol, XLogP of 2.43, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,6-dimethylpyrazin-2-yl)-methylamino]-3-phenylthiourea is sourced from PubChem (CID 852690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).