C39H48O5 — CID 85270146
methyl 2-(3-hydroxy-2,6,14-trimethyl-9-phenyl-8-oxahexacyclo[16.3.1.01,18.02,15.05,14.06,11]docosa-11,16-dien-19-yl)-3-(4-methylfuran-2-yl)propanoate (PubChem CID 85270146) has the molecular formula C39H48O5 and a molecular weight of 596.81 g/mol. Its IUPAC name is methyl 2-(3-hydroxy-2,6,14-trimethyl-9-phenyl-8-oxahexacyclo[16.3.1.01,18.02,15.05,14.06,11]docosa-11,16-dien-19-yl)-3-(4-methylfuran-2-yl)propanoate.
| Compound Name | methyl 2-(3-hydroxy-2,6,14-trimethyl-9-phenyl-8-oxahexacyclo[16.3.1.01,18.02,15.05,14.06,11]docosa-11,16-dien-19-yl)-3-(4-methylfuran-2-yl)propanoate |
|---|---|
| PubChem CID | 85270146 |
| Molecular Formula | C39H48O5 |
| Molecular Weight | 596.81 g/mol |
| Exact Mass | 596.35 |
| IUPAC Name | methyl 2-(3-hydroxy-2,6,14-trimethyl-9-phenyl-8-oxahexacyclo[16.3.1.01,18.02,15.05,14.06,11]docosa-11,16-dien-19-yl)-3-(4-methylfuran-2-yl)propanoate |
| SMILES | COC(=O)C(Cc1cc(C)co1)C1CCC23CC12C=CC1C2(C)CC=C4CC(c5ccccc5)OCC4(C)C2CC(O)C13C |
| InChI | InChI=1S/C39H48O5/c1-24-17-27(43-21-24)19-28(34(41)42-5)29-12-16-39-22-38(29,39)15-13-31-35(2)14-11-26-18-30(25-9-7-6-8-10-25)44-23-36(26,3)32(35)20-33(40)37(31,39)4/h6-11,13,15,17,21,28-33,40H,12,14,16,18-20,22-23H2,1-5H3 |
| InChIKey | CPSWQVFBILRJMT-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.81 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|