C35H52O8 — CID 85270169
6'-but-2-en-2-yl-3',8,9-trihydroxy-7-methoxy-5',6,10,14,16-pentamethylspiro[2,20-dioxatricyclo[17.3.1.04,9]tricosa-5,10,12,16-tetraene-21,2'-oxane]-3-one (PubChem CID 85270169) has the molecular formula C35H52O8 and a molecular weight of 600.79 g/mol. Its IUPAC name is 6'-but-2-en-2-yl-3',8,9-trihydroxy-7-methoxy-5',6,10,14,16-pentamethylspiro[2,20-dioxatricyclo[17.3.1.04,9]tricosa-5,10,12,16-tetraene-21,2'-oxane]-3-one.
| Compound Name | 6'-but-2-en-2-yl-3',8,9-trihydroxy-7-methoxy-5',6,10,14,16-pentamethylspiro[2,20-dioxatricyclo[17.3.1.04,9]tricosa-5,10,12,16-tetraene-21,2'-oxane]-3-one |
|---|---|
| PubChem CID | 85270169 |
| Molecular Formula | C35H52O8 |
| Molecular Weight | 600.79 g/mol |
| Exact Mass | 600.37 |
| IUPAC Name | 6'-but-2-en-2-yl-3',8,9-trihydroxy-7-methoxy-5',6,10,14,16-pentamethylspiro[2,20-dioxatricyclo[17.3.1.04,9]tricosa-5,10,12,16-tetraene-21,2'-oxane]-3-one |
| SMILES | CC=C(C)C1OC2(CC3CC(CC=C(C)CC(C)C=CC=C(C)C4(O)C(C=C(C)C(OC)C4O)C(=O)O3)O2)C(O)CC1C |
| InChI | InChI=1S/C35H52O8/c1-9-22(4)30-24(6)17-29(36)34(43-30)19-27-18-26(42-34)14-13-21(3)15-20(2)11-10-12-25(7)35(39)28(33(38)41-27)16-23(5)31(40-8)32(35)37/h9-13,16,20,24,26-32,36-37,39H,14-15,17-19H2,1-8H3 |
| InChIKey | AZADTSXNOSADFV-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.79 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|