About 4-hydroxy-1,8-dimethyl-4-propan-2-ylspiro[4.5]decane-3,9-dione
4-hydroxy-1,8-dimethyl-4-propan-2-ylspiro[4.5]decane-3,9-dione (PubChem CID 85272666) has the molecular formula C15H24O3
and a molecular weight of 252.35 g/mol. Its IUPAC name is 4-hydroxy-1,8-dimethyl-4-propan-2-ylspiro[4.5]decane-3,9-dione.
Molecular Properties
| Compound Name | 4-hydroxy-1,8-dimethyl-4-propan-2-ylspiro[4.5]decane-3,9-dione |
| PubChem CID | 85272666 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 4-hydroxy-1,8-dimethyl-4-propan-2-ylspiro[4.5]decane-3,9-dione |
| SMILES | CC1CCC2(CC1=O)C(C)CC(=O)C2(O)C(C)C |
| InChI | InChI=1S/C15H24O3/c1-9(2)15(18)13(17)7-11(4)14(15)6-5-10(3)12(16)8-14/h9-11,18H,5-8H2,1-4H3 |
| InChIKey | LSSIJCQOMTUIIN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-hydroxy-1,8-dimethyl-4-propan-2-ylspiro[4.5]decane-3,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-1,8-dimethyl-4-propan-2-ylspiro[4.5]decane-3,9-dione?
The IUPAC name of 4-hydroxy-1,8-dimethyl-4-propan-2-ylspiro[4.5]decane-3,9-dione (CID 85272666) is 4-hydroxy-1,8-dimethyl-4-propan-2-ylspiro[4.5]decane-3,9-dione.
What is the SMILES notation for 4-hydroxy-1,8-dimethyl-4-propan-2-ylspiro[4.5]decane-3,9-dione?
The canonical SMILES for 4-hydroxy-1,8-dimethyl-4-propan-2-ylspiro[4.5]decane-3,9-dione is CC1CCC2(CC1=O)C(C)CC(=O)C2(O)C(C)C.
What is the InChIKey of 4-hydroxy-1,8-dimethyl-4-propan-2-ylspiro[4.5]decane-3,9-dione?
The InChIKey is LSSIJCQOMTUIIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O3/c1-9(2)15(18)13(17)7-11(4)14(15)6-5-10(3)12(16)8-14/h9-11,18H,5-8H2,1-4H3.
What are the key properties of 4-hydroxy-1,8-dimethyl-4-propan-2-ylspiro[4.5]decane-3,9-dione?
4-hydroxy-1,8-dimethyl-4-propan-2-ylspiro[4.5]decane-3,9-dione has a molecular weight of 252.35 g/mol, XLogP of 2.36, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-1,8-dimethyl-4-propan-2-ylspiro[4.5]decane-3,9-dione is sourced from PubChem (CID 85272666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).