C15H26O3 — CID 85272695
1-(2,4-dihydroxy-4a,8,8-trimethyl-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-yl)ethanone (PubChem CID 85272695) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is 1-(2,4-dihydroxy-4a,8,8-trimethyl-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-yl)ethanone.
| Compound Name | 1-(2,4-dihydroxy-4a,8,8-trimethyl-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-yl)ethanone |
|---|---|
| PubChem CID | 85272695 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 1-(2,4-dihydroxy-4a,8,8-trimethyl-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-yl)ethanone |
| SMILES | CC(=O)C1C(O)CC(O)C2(C)CCCC(C)(C)C12 |
| InChI | InChI=1S/C15H26O3/c1-9(16)12-10(17)8-11(18)15(4)7-5-6-14(2,3)13(12)15/h10-13,17-18H,5-8H2,1-4H3 |
| InChIKey | FIPQUFXNPGNDFR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |