About (3R,4S)-3-methyl-1,4-diphenylazetidin-2-one
(3R,4S)-3-methyl-1,4-diphenylazetidin-2-one (PubChem CID 852748) has the molecular formula C16H15NO
and a molecular weight of 237.30 g/mol. Its IUPAC name is (3R,4S)-3-methyl-1,4-diphenylazetidin-2-one.
Molecular Properties
| Compound Name | (3R,4S)-3-methyl-1,4-diphenylazetidin-2-one |
| PubChem CID | 852748 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | (3R,4S)-3-methyl-1,4-diphenylazetidin-2-one |
| SMILES | C[C@H]1C(=O)N(c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H15NO/c1-12-15(13-8-4-2-5-9-13)17(16(12)18)14-10-6-3-7-11-14/h2-12,15H,1H3/t12-,15+/m1/s1 |
| InChIKey | QURMOGAHPSNBBS-DOMZBBRYSA-N |
| XLogP | 3.41 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3R,4S)-3-methyl-1,4-diphenylazetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-3-methyl-1,4-diphenylazetidin-2-one?
The IUPAC name of (3R,4S)-3-methyl-1,4-diphenylazetidin-2-one (CID 852748) is (3R,4S)-3-methyl-1,4-diphenylazetidin-2-one.
What is the SMILES notation for (3R,4S)-3-methyl-1,4-diphenylazetidin-2-one?
The canonical SMILES for (3R,4S)-3-methyl-1,4-diphenylazetidin-2-one is C[C@H]1C(=O)N(c2ccccc2)[C@@H]1c1ccccc1.
What is the InChIKey of (3R,4S)-3-methyl-1,4-diphenylazetidin-2-one?
The InChIKey is QURMOGAHPSNBBS-DOMZBBRYSA-N. The full InChI is InChI=1S/C16H15NO/c1-12-15(13-8-4-2-5-9-13)17(16(12)18)14-10-6-3-7-11-14/h2-12,15H,1H3/t12-,15+/m1/s1.
What are the key properties of (3R,4S)-3-methyl-1,4-diphenylazetidin-2-one?
(3R,4S)-3-methyl-1,4-diphenylazetidin-2-one has a molecular weight of 237.30 g/mol, XLogP of 3.41, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-3-methyl-1,4-diphenylazetidin-2-one is sourced from PubChem (CID 852748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).