C21H21NO6 — CID 8527714
(2-benzamido-2-oxoethyl) 2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]acetate (PubChem CID 8527714) has the molecular formula C21H21NO6 and a molecular weight of 383.40 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) 2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]acetate.
| Compound Name | (2-benzamido-2-oxoethyl) 2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]acetate |
|---|---|
| PubChem CID | 8527714 |
| Molecular Formula | C21H21NO6 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | (2-benzamido-2-oxoethyl) 2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]acetate |
| SMILES | C/C=C/c1ccc(OCC(=O)OCC(=O)NC(=O)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C21H21NO6/c1-3-7-15-10-11-17(18(12-15)26-2)27-14-20(24)28-13-19(23)22-21(25)16-8-5-4-6-9-16/h3-12H,13-14H2,1-2H3,(H,22,23,25)/b7-3+ |
| InChIKey | XXTJYWAQGSCGPT-XVNBXDOJSA-N |
| XLogP | 2.61 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |