C23H36O11S — CID 85277467
[4,5-diacetyloxy-6-[(4-ethylsulfanyl-2,2,6-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl)oxy]-2-methyloxan-3-yl] acetate (PubChem CID 85277467) has the molecular formula C23H36O11S and a molecular weight of 520.60 g/mol. Its IUPAC name is [4,5-diacetyloxy-6-[(4-ethylsulfanyl-2,2,6-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl)oxy]-2-methyloxan-3-yl] acetate.
| Compound Name | [4,5-diacetyloxy-6-[(4-ethylsulfanyl-2,2,6-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl)oxy]-2-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 85277467 |
| Molecular Formula | C23H36O11S |
| Molecular Weight | 520.60 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | [4,5-diacetyloxy-6-[(4-ethylsulfanyl-2,2,6-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl)oxy]-2-methyloxan-3-yl] acetate |
| SMILES | CCSC1OC(C)C(OC2OC(C)C(OC(C)=O)C(OC(C)=O)C2OC(C)=O)C2OC(C)(C)OC12 |
| InChI | InChI=1S/C23H36O11S/c1-9-35-22-20-18(33-23(7,8)34-20)16(11(3)28-22)32-21-19(31-14(6)26)17(30-13(5)25)15(10(2)27-21)29-12(4)24/h10-11,15-22H,9H2,1-8H3 |
| InChIKey | IPOCKBLLGMTPEA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 125.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.60 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|