C11H11NO — CID 85279786
6,7-dimethyl-8aH-isoquinolin-1-one (PubChem CID 85279786) has the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. Its IUPAC name is 6,7-dimethyl-8aH-isoquinolin-1-one.
| Compound Name | 6,7-dimethyl-8aH-isoquinolin-1-one |
|---|---|
| PubChem CID | 85279786 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 6,7-dimethyl-8aH-isoquinolin-1-one |
| SMILES | CC1=CC2=CC=NC(=O)C2C=C1C |
| InChI | InChI=1S/C11H11NO/c1-7-5-9-3-4-12-11(13)10(9)6-8(7)2/h3-6,10H,1-2H3 |
| InChIKey | VIOGRBNYFYPZGD-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |