C26H16N4S2 — CID 85284439
8,10,23,25-tetrazapentacyclo[24.4.0.02,7.011,16.017,22]triaconta-1,3,5,7,10,12,14,16,18,20,22,25,27,29-tetradecaene-9,24-dithione (PubChem CID 85284439) has the molecular formula C26H16N4S2 and a molecular weight of 448.58 g/mol. Its IUPAC name is 8,10,23,25-tetrazapentacyclo[24.4.0.02,7.011,16.017,22]triaconta-1,3,5,7,10,12,14,16,18,20,22,25,27,29-tetradecaene-9,24-dithione.
| Compound Name | 8,10,23,25-tetrazapentacyclo[24.4.0.02,7.011,16.017,22]triaconta-1,3,5,7,10,12,14,16,18,20,22,25,27,29-tetradecaene-9,24-dithione |
|---|---|
| PubChem CID | 85284439 |
| Molecular Formula | C26H16N4S2 |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 8,10,23,25-tetrazapentacyclo[24.4.0.02,7.011,16.017,22]triaconta-1,3,5,7,10,12,14,16,18,20,22,25,27,29-tetradecaene-9,24-dithione |
| SMILES | S=C1N=c2ccccc2=c2ccccc2=NC(=S)N=c2ccccc2=c2ccccc2=N1 |
| InChI | InChI=1S/C26H16N4S2/c31-25-27-21-13-5-1-9-17(21)18-10-2-6-14-22(18)28-26(32)30-24-16-8-4-12-20(24)19-11-3-7-15-23(19)29-25/h1-16H |
| InChIKey | LLXRNWJDALRRGD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|