C31H50O4Si — CID 85285312
1-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carboxylic acid (PubChem CID 85285312) has the molecular formula C31H50O4Si and a molecular weight of 514.82 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carboxylic acid.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carboxylic acid |
|---|---|
| PubChem CID | 85285312 |
| Molecular Formula | C31H50O4Si |
| Molecular Weight | 514.82 g/mol |
| Exact Mass | 514.35 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carboxylic acid |
| SMILES | CCCCCCC(C)(C)c1cc2c(c(O[Si](C)(C)C(C)(C)C)c1)C1CC(C(=O)O)=CCC1C(C)(C)O2 |
| InChI | InChI=1S/C31H50O4Si/c1-11-12-13-14-17-30(5,6)22-19-25-27(26(20-22)35-36(9,10)29(2,3)4)23-18-21(28(32)33)15-16-24(23)31(7,8)34-25/h15,19-20,23-24H,11-14,16-18H2,1-10H3,(H,32,33) |
| InChIKey | RBZLBZZWAYKAPZ-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.82 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|