About tricyclo[3.3.0.03,7]octane-2,6-diol
tricyclo[3.3.0.03,7]octane-2,6-diol (PubChem CID 85287592) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is tricyclo[3.3.0.03,7]octane-2,6-diol.
Molecular Properties
| Compound Name | tricyclo[3.3.0.03,7]octane-2,6-diol |
| PubChem CID | 85287592 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | tricyclo[3.3.0.03,7]octane-2,6-diol |
| SMILES | OC1C2CC3C(O)C2CC13 |
| InChI | InChI=1S/C8H12O2/c9-7-3-1-4-6(7)2-5(3)8(4)10/h3-10H,1-2H2 |
| InChIKey | DEZZVLQETJEPHD-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tricyclo[3.3.0.03,7]octane-2,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[3.3.0.03,7]octane-2,6-diol?
The IUPAC name of tricyclo[3.3.0.03,7]octane-2,6-diol (CID 85287592) is tricyclo[3.3.0.03,7]octane-2,6-diol.
What is the SMILES notation for tricyclo[3.3.0.03,7]octane-2,6-diol?
The canonical SMILES for tricyclo[3.3.0.03,7]octane-2,6-diol is OC1C2CC3C(O)C2CC13.
What is the InChIKey of tricyclo[3.3.0.03,7]octane-2,6-diol?
The InChIKey is DEZZVLQETJEPHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O2/c9-7-3-1-4-6(7)2-5(3)8(4)10/h3-10H,1-2H2.
What are the key properties of tricyclo[3.3.0.03,7]octane-2,6-diol?
tricyclo[3.3.0.03,7]octane-2,6-diol has a molecular weight of 140.18 g/mol, XLogP of -0.01, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[3.3.0.03,7]octane-2,6-diol is sourced from PubChem (CID 85287592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).