About N,N,3-trimethylpentanamide
N,N,3-trimethylpentanamide (PubChem CID 85290591) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is N,N,3-trimethylpentanamide.
Molecular Properties
| Compound Name | N,N,3-trimethylpentanamide |
| PubChem CID | 85290591 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | N,N,3-trimethylpentanamide |
| SMILES | CCC(C)CC(=O)N(C)C |
| InChI | InChI=1S/C8H17NO/c1-5-7(2)6-8(10)9(3)4/h7H,5-6H2,1-4H3 |
| InChIKey | GRQKXQAOEDQPKW-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N,3-trimethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N,3-trimethylpentanamide?
The IUPAC name of N,N,3-trimethylpentanamide (CID 85290591) is N,N,3-trimethylpentanamide.
What is the SMILES notation for N,N,3-trimethylpentanamide?
The canonical SMILES for N,N,3-trimethylpentanamide is CCC(C)CC(=O)N(C)C.
What is the InChIKey of N,N,3-trimethylpentanamide?
The InChIKey is GRQKXQAOEDQPKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO/c1-5-7(2)6-8(10)9(3)4/h7H,5-6H2,1-4H3.
What are the key properties of N,N,3-trimethylpentanamide?
N,N,3-trimethylpentanamide has a molecular weight of 143.23 g/mol, XLogP of 1.51, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N,3-trimethylpentanamide is sourced from PubChem (CID 85290591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).