C19H30O9 — CID 85292881
4,6-dihydroxy-3,5,5-trimethyl-4-[3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-1-enyl]cyclohex-2-en-1-one (PubChem CID 85292881) has the molecular formula C19H30O9 and a molecular weight of 402.44 g/mol. Its IUPAC name is 4,6-dihydroxy-3,5,5-trimethyl-4-[3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-1-enyl]cyclohex-2-en-1-one.
| Compound Name | 4,6-dihydroxy-3,5,5-trimethyl-4-[3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-1-enyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 85292881 |
| Molecular Formula | C19H30O9 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 4,6-dihydroxy-3,5,5-trimethyl-4-[3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-1-enyl]cyclohex-2-en-1-one |
| SMILES | CC1=CC(=O)C(O)C(C)(C)C1(O)C=CC(C)OC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C19H30O9/c1-9-7-11(21)16(25)18(3,4)19(9,26)6-5-10(2)27-17-15(24)14(23)13(22)12(8-20)28-17/h5-7,10,12-17,20,22-26H,8H2,1-4H3 |
| InChIKey | UPFYDFUDOLTMGS-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 156.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|