About 2,6-dimethylhept-4-en-3-ol
2,6-dimethylhept-4-en-3-ol (PubChem CID 85294890) has the molecular formula C9H18O
and a molecular weight of 142.24 g/mol. Its IUPAC name is 2,6-dimethylhept-4-en-3-ol.
Molecular Properties
| Compound Name | 2,6-dimethylhept-4-en-3-ol |
| PubChem CID | 85294890 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | 2,6-dimethylhept-4-en-3-ol |
| SMILES | CC(C)C=CC(O)C(C)C |
| InChI | InChI=1S/C9H18O/c1-7(2)5-6-9(10)8(3)4/h5-10H,1-4H3 |
| InChIKey | BDEWQLXPXANDJE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethylhept-4-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethylhept-4-en-3-ol?
The IUPAC name of 2,6-dimethylhept-4-en-3-ol (CID 85294890) is 2,6-dimethylhept-4-en-3-ol.
What is the SMILES notation for 2,6-dimethylhept-4-en-3-ol?
The canonical SMILES for 2,6-dimethylhept-4-en-3-ol is CC(C)C=CC(O)C(C)C.
What is the InChIKey of 2,6-dimethylhept-4-en-3-ol?
The InChIKey is BDEWQLXPXANDJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O/c1-7(2)5-6-9(10)8(3)4/h5-10H,1-4H3.
What are the key properties of 2,6-dimethylhept-4-en-3-ol?
2,6-dimethylhept-4-en-3-ol has a molecular weight of 142.24 g/mol, XLogP of 2.22, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethylhept-4-en-3-ol is sourced from PubChem (CID 85294890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).