About N-tert-butyl-2,4-bis(trimethylsilyl)but-3-en-1-imine
N-tert-butyl-2,4-bis(trimethylsilyl)but-3-en-1-imine (PubChem CID 85295665) has the molecular formula C14H31NSi2
and a molecular weight of 269.58 g/mol. Its IUPAC name is N-tert-butyl-2,4-bis(trimethylsilyl)but-3-en-1-imine.
Molecular Properties
| Compound Name | N-tert-butyl-2,4-bis(trimethylsilyl)but-3-en-1-imine |
| PubChem CID | 85295665 |
| Molecular Formula | C14H31NSi2 |
| Molecular Weight | 269.58 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | N-tert-butyl-2,4-bis(trimethylsilyl)but-3-en-1-imine |
| SMILES | CC(C)(C)/N=C/C(C=C[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C14H31NSi2/c1-14(2,3)15-12-13(17(7,8)9)10-11-16(4,5)6/h10-13H,1-9H3/b11-10?,15-12+ |
| InChIKey | VLWJIKKHKMCBMX-ODDDKGJZSA-N |
| XLogP | 5.00 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.58 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-2,4-bis(trimethylsilyl)but-3-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2,4-bis(trimethylsilyl)but-3-en-1-imine?
The IUPAC name of N-tert-butyl-2,4-bis(trimethylsilyl)but-3-en-1-imine (CID 85295665) is N-tert-butyl-2,4-bis(trimethylsilyl)but-3-en-1-imine.
What is the SMILES notation for N-tert-butyl-2,4-bis(trimethylsilyl)but-3-en-1-imine?
The canonical SMILES for N-tert-butyl-2,4-bis(trimethylsilyl)but-3-en-1-imine is CC(C)(C)/N=C/C(C=C[Si](C)(C)C)[Si](C)(C)C.
What is the InChIKey of N-tert-butyl-2,4-bis(trimethylsilyl)but-3-en-1-imine?
The InChIKey is VLWJIKKHKMCBMX-ODDDKGJZSA-N. The full InChI is InChI=1S/C14H31NSi2/c1-14(2,3)15-12-13(17(7,8)9)10-11-16(4,5)6/h10-13H,1-9H3/b11-10?,15-12+.
What are the key properties of N-tert-butyl-2,4-bis(trimethylsilyl)but-3-en-1-imine?
N-tert-butyl-2,4-bis(trimethylsilyl)but-3-en-1-imine has a molecular weight of 269.58 g/mol, XLogP of 5.00, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2,4-bis(trimethylsilyl)but-3-en-1-imine is sourced from PubChem (CID 85295665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).