About (2-amino-2-oxoethyl) 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoate
(2-amino-2-oxoethyl) 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoate (PubChem CID 8529738) has the molecular formula C12H17N3O3S
and a molecular weight of 283.35 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoate.
Molecular Properties
| Compound Name | (2-amino-2-oxoethyl) 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoate |
| PubChem CID | 8529738 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (2-amino-2-oxoethyl) 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoate |
| SMILES | CSc1nc(C)c(CCC(=O)OCC(N)=O)c(C)n1 |
| InChI | InChI=1S/C12H17N3O3S/c1-7-9(8(2)15-12(14-7)19-3)4-5-11(17)18-6-10(13)16/h4-6H2,1-3H3,(H2,13,16) |
| InChIKey | KGFDTKLDHURYAI-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2-amino-2-oxoethyl) 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-2-oxoethyl) 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoate?
The IUPAC name of (2-amino-2-oxoethyl) 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoate (CID 8529738) is (2-amino-2-oxoethyl) 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoate.
What is the SMILES notation for (2-amino-2-oxoethyl) 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoate?
The canonical SMILES for (2-amino-2-oxoethyl) 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoate is CSc1nc(C)c(CCC(=O)OCC(N)=O)c(C)n1.
What is the InChIKey of (2-amino-2-oxoethyl) 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoate?
The InChIKey is KGFDTKLDHURYAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O3S/c1-7-9(8(2)15-12(14-7)19-3)4-5-11(17)18-6-10(13)16/h4-6H2,1-3H3,(H2,13,16).
What are the key properties of (2-amino-2-oxoethyl) 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoate?
(2-amino-2-oxoethyl) 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoate has a molecular weight of 283.35 g/mol, XLogP of 0.78, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-2-oxoethyl) 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoate is sourced from PubChem (CID 8529738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).