C23H31ClN3O+ — CID 8529789
(2R)-N-[2-[(2R)-butan-2-yl]phenyl]-2-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]propanamide (PubChem CID 8529789) has the molecular formula C23H31ClN3O+ and a molecular weight of 400.97 g/mol. Its IUPAC name is (2R)-N-[2-[(2R)-butan-2-yl]phenyl]-2-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]propanamide.
| Compound Name | (2R)-N-[2-[(2R)-butan-2-yl]phenyl]-2-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]propanamide |
|---|---|
| PubChem CID | 8529789 |
| Molecular Formula | C23H31ClN3O+ |
| Molecular Weight | 400.97 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | (2R)-N-[2-[(2R)-butan-2-yl]phenyl]-2-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]propanamide |
| SMILES | CC[C@@H](C)c1ccccc1NC(=O)[C@@H](C)[NH+]1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C23H30ClN3O/c1-4-17(2)21-10-5-6-11-22(21)25-23(28)18(3)26-12-14-27(15-13-26)20-9-7-8-19(24)16-20/h5-11,16-18H,4,12-15H2,1-3H3,(H,25,28)/p+1/t17-,18-/m1/s1 |
| InChIKey | VBVHCAKQKQWVQZ-QZTJIDSGSA-O |
| XLogP | 3.59 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.97 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |