About tricyclo[5.2.1.02,6]dec-8-ene-3,5-diol
tricyclo[5.2.1.02,6]dec-8-ene-3,5-diol (PubChem CID 85299267) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is tricyclo[5.2.1.02,6]dec-8-ene-3,5-diol.
Molecular Properties
| Compound Name | tricyclo[5.2.1.02,6]dec-8-ene-3,5-diol |
| PubChem CID | 85299267 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | tricyclo[5.2.1.02,6]dec-8-ene-3,5-diol |
| SMILES | OC1CC(O)C2C3C=CC(C3)C12 |
| InChI | InChI=1S/C10H14O2/c11-7-4-8(12)10-6-2-1-5(3-6)9(7)10/h1-2,5-12H,3-4H2 |
| InChIKey | CNPHCFOUWRFDEM-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tricyclo[5.2.1.02,6]dec-8-ene-3,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[5.2.1.02,6]dec-8-ene-3,5-diol?
The IUPAC name of tricyclo[5.2.1.02,6]dec-8-ene-3,5-diol (CID 85299267) is tricyclo[5.2.1.02,6]dec-8-ene-3,5-diol.
What is the SMILES notation for tricyclo[5.2.1.02,6]dec-8-ene-3,5-diol?
The canonical SMILES for tricyclo[5.2.1.02,6]dec-8-ene-3,5-diol is OC1CC(O)C2C3C=CC(C3)C12.
What is the InChIKey of tricyclo[5.2.1.02,6]dec-8-ene-3,5-diol?
The InChIKey is CNPHCFOUWRFDEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2/c11-7-4-8(12)10-6-2-1-5(3-6)9(7)10/h1-2,5-12H,3-4H2.
What are the key properties of tricyclo[5.2.1.02,6]dec-8-ene-3,5-diol?
tricyclo[5.2.1.02,6]dec-8-ene-3,5-diol has a molecular weight of 166.22 g/mol, XLogP of 0.55, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[5.2.1.02,6]dec-8-ene-3,5-diol is sourced from PubChem (CID 85299267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).