About 3-(dimethylamino)prop-2-enylidene-dimethylazanium perchlorate
3-(dimethylamino)prop-2-enylidene-dimethylazanium perchlorate (PubChem CID 85299619) has the molecular formula C7H15ClN2O4
and a molecular weight of 226.66 g/mol. Its IUPAC name is 3-(dimethylamino)prop-2-enylidene-dimethylazanium perchlorate.
Molecular Properties
| Compound Name | 3-(dimethylamino)prop-2-enylidene-dimethylazanium perchlorate |
| PubChem CID | 85299619 |
| Molecular Formula | C7H15ClN2O4 |
| Molecular Weight | 226.66 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 3-(dimethylamino)prop-2-enylidene-dimethylazanium perchlorate |
| SMILES | CN(C)C=CC=[N+](C)C.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C7H15N2.ClHO4/c1-8(2)6-5-7-9(3)4;2-1(3,4)5/h5-7H,1-4H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | KPEJCTFEDXAYIE-UHFFFAOYSA-M |
| XLogP | -4.35 |
| TPSA | 98.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.66 |
| LogP ≤ 5 | -4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(dimethylamino)prop-2-enylidene-dimethylazanium perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)prop-2-enylidene-dimethylazanium perchlorate?
The IUPAC name of 3-(dimethylamino)prop-2-enylidene-dimethylazanium perchlorate (CID 85299619) is 3-(dimethylamino)prop-2-enylidene-dimethylazanium perchlorate.
What is the SMILES notation for 3-(dimethylamino)prop-2-enylidene-dimethylazanium perchlorate?
The canonical SMILES for 3-(dimethylamino)prop-2-enylidene-dimethylazanium perchlorate is CN(C)C=CC=[N+](C)C.[O-][Cl+3]([O-])([O-])[O-].
What is the InChIKey of 3-(dimethylamino)prop-2-enylidene-dimethylazanium perchlorate?
The InChIKey is KPEJCTFEDXAYIE-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H15N2.ClHO4/c1-8(2)6-5-7-9(3)4;2-1(3,4)5/h5-7H,1-4H3;(H,2,3,4,5)/q+1;/p-1.
What are the key properties of 3-(dimethylamino)prop-2-enylidene-dimethylazanium perchlorate?
3-(dimethylamino)prop-2-enylidene-dimethylazanium perchlorate has a molecular weight of 226.66 g/mol, XLogP of -4.35, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)prop-2-enylidene-dimethylazanium perchlorate is sourced from PubChem (CID 85299619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).