About N-cyclohexyl-3,7-dimethylocta-2,6-dien-1-imine
N-cyclohexyl-3,7-dimethylocta-2,6-dien-1-imine (PubChem CID 85299666) has the molecular formula C16H27N
and a molecular weight of 233.40 g/mol. Its IUPAC name is N-cyclohexyl-3,7-dimethylocta-2,6-dien-1-imine.
Molecular Properties
| Compound Name | N-cyclohexyl-3,7-dimethylocta-2,6-dien-1-imine |
| PubChem CID | 85299666 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | N-cyclohexyl-3,7-dimethylocta-2,6-dien-1-imine |
| SMILES | CC(C)=CCCC(C)=C/C=N/C1CCCCC1 |
| InChI | InChI=1S/C16H27N/c1-14(2)8-7-9-15(3)12-13-17-16-10-5-4-6-11-16/h8,12-13,16H,4-7,9-11H2,1-3H3/b15-12?,17-13+ |
| InChIKey | UODVUXCLEHZKJE-ONENNTDASA-N |
| XLogP | 5.08 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexyl-3,7-dimethylocta-2,6-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-3,7-dimethylocta-2,6-dien-1-imine?
The IUPAC name of N-cyclohexyl-3,7-dimethylocta-2,6-dien-1-imine (CID 85299666) is N-cyclohexyl-3,7-dimethylocta-2,6-dien-1-imine.
What is the SMILES notation for N-cyclohexyl-3,7-dimethylocta-2,6-dien-1-imine?
The canonical SMILES for N-cyclohexyl-3,7-dimethylocta-2,6-dien-1-imine is CC(C)=CCCC(C)=C/C=N/C1CCCCC1.
What is the InChIKey of N-cyclohexyl-3,7-dimethylocta-2,6-dien-1-imine?
The InChIKey is UODVUXCLEHZKJE-ONENNTDASA-N. The full InChI is InChI=1S/C16H27N/c1-14(2)8-7-9-15(3)12-13-17-16-10-5-4-6-11-16/h8,12-13,16H,4-7,9-11H2,1-3H3/b15-12?,17-13+.
What are the key properties of N-cyclohexyl-3,7-dimethylocta-2,6-dien-1-imine?
N-cyclohexyl-3,7-dimethylocta-2,6-dien-1-imine has a molecular weight of 233.40 g/mol, XLogP of 5.08, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-3,7-dimethylocta-2,6-dien-1-imine is sourced from PubChem (CID 85299666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).