About (1R,2R)-1,2-diphenylethane-1,2-diol
(1R,2R)-1,2-diphenylethane-1,2-diol (PubChem CID 853019) has the molecular formula C14H14O2
and a molecular weight of 214.26 g/mol. Its IUPAC name is (1R,2R)-1,2-diphenylethane-1,2-diol.
Molecular Properties
| Compound Name | (1R,2R)-1,2-diphenylethane-1,2-diol |
| PubChem CID | 853019 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | (1R,2R)-1,2-diphenylethane-1,2-diol |
| SMILES | O[C@H](c1ccccc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C14H14O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-16H/t13-,14-/m1/s1 |
| InChIKey | IHPDTPWNFBQHEB-ZIAGYGMSSA-N |
| XLogP | 2.45 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R,2R)-1,2-diphenylethane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2R)-1,2-diphenylethane-1,2-diol?
The IUPAC name of (1R,2R)-1,2-diphenylethane-1,2-diol (CID 853019) is (1R,2R)-1,2-diphenylethane-1,2-diol.
What is the SMILES notation for (1R,2R)-1,2-diphenylethane-1,2-diol?
The canonical SMILES for (1R,2R)-1,2-diphenylethane-1,2-diol is O[C@H](c1ccccc1)[C@H](O)c1ccccc1.
What is the InChIKey of (1R,2R)-1,2-diphenylethane-1,2-diol?
The InChIKey is IHPDTPWNFBQHEB-ZIAGYGMSSA-N. The full InChI is InChI=1S/C14H14O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-16H/t13-,14-/m1/s1.
What are the key properties of (1R,2R)-1,2-diphenylethane-1,2-diol?
(1R,2R)-1,2-diphenylethane-1,2-diol has a molecular weight of 214.26 g/mol, XLogP of 2.45, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2R)-1,2-diphenylethane-1,2-diol is sourced from PubChem (CID 853019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).