About [2-(2,6-difluoroanilino)-2-oxoethyl] 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoate
[2-(2,6-difluoroanilino)-2-oxoethyl] 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoate (PubChem CID 8530282) has the molecular formula C18H19F2N3O3S
and a molecular weight of 395.43 g/mol. Its IUPAC name is [2-(2,6-difluoroanilino)-2-oxoethyl] 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoate.
Molecular Properties
| Compound Name | [2-(2,6-difluoroanilino)-2-oxoethyl] 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoate |
| PubChem CID | 8530282 |
| Molecular Formula | C18H19F2N3O3S |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | [2-(2,6-difluoroanilino)-2-oxoethyl] 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoate |
| SMILES | CSc1nc(C)c(CCC(=O)OCC(=O)Nc2c(F)cccc2F)c(C)n1 |
| InChI | InChI=1S/C18H19F2N3O3S/c1-10-12(11(2)22-18(21-10)27-3)7-8-16(25)26-9-15(24)23-17-13(19)5-4-6-14(17)20/h4-6H,7-9H2,1-3H3,(H,23,24) |
| InChIKey | QOYUSWGMTHRBNT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(2,6-difluoroanilino)-2-oxoethyl] 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,6-difluoroanilino)-2-oxoethyl] 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoate?
The IUPAC name of [2-(2,6-difluoroanilino)-2-oxoethyl] 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoate (CID 8530282) is [2-(2,6-difluoroanilino)-2-oxoethyl] 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoate.
What is the SMILES notation for [2-(2,6-difluoroanilino)-2-oxoethyl] 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoate?
The canonical SMILES for [2-(2,6-difluoroanilino)-2-oxoethyl] 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoate is CSc1nc(C)c(CCC(=O)OCC(=O)Nc2c(F)cccc2F)c(C)n1.
What is the InChIKey of [2-(2,6-difluoroanilino)-2-oxoethyl] 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoate?
The InChIKey is QOYUSWGMTHRBNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19F2N3O3S/c1-10-12(11(2)22-18(21-10)27-3)7-8-16(25)26-9-15(24)23-17-13(19)5-4-6-14(17)20/h4-6H,7-9H2,1-3H3,(H,23,24).
What are the key properties of [2-(2,6-difluoroanilino)-2-oxoethyl] 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoate?
[2-(2,6-difluoroanilino)-2-oxoethyl] 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoate has a molecular weight of 395.43 g/mol, XLogP of 3.21, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,6-difluoroanilino)-2-oxoethyl] 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoate is sourced from PubChem (CID 8530282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).