C16H26N2 — CID 85304123
3-methyl-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene (PubChem CID 85304123) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 3-methyl-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene.
| Compound Name | 3-methyl-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene |
|---|---|
| PubChem CID | 85304123 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 3-methyl-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene |
| SMILES | CN1CCCC2=CC3CC(CN4CCCCC34)C21 |
| InChI | InChI=1S/C16H26N2/c1-17-7-4-5-12-9-13-10-14(16(12)17)11-18-8-3-2-6-15(13)18/h9,13-16H,2-8,10-11H2,1H3 |
| InChIKey | YGHOKBSKQNTRCZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|