C18H18F3N3O3S — CID 8530474
[2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoate (PubChem CID 8530474) has the molecular formula C18H18F3N3O3S and a molecular weight of 413.42 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoate.
| Compound Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoate |
|---|---|
| PubChem CID | 8530474 |
| Molecular Formula | C18H18F3N3O3S |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoate |
| SMILES | CSc1nc(C)c(CCC(=O)OCC(=O)Nc2ccc(F)c(F)c2F)c(C)n1 |
| InChI | InChI=1S/C18H18F3N3O3S/c1-9-11(10(2)23-18(22-9)28-3)4-7-15(26)27-8-14(25)24-13-6-5-12(19)16(20)17(13)21/h5-6H,4,7-8H2,1-3H3,(H,24,25) |
| InChIKey | USBUTDGVFUDMHB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|