C23H25N3O3S — CID 8530631
(2S)-1-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]piperidine-2-carboxamide (PubChem CID 8530631) has the molecular formula C23H25N3O3S and a molecular weight of 423.54 g/mol. Its IUPAC name is (2S)-1-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]piperidine-2-carboxamide.
| Compound Name | (2S)-1-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 8530631 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | (2S)-1-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]piperidine-2-carboxamide |
| SMILES | O=C(N[C@@H]1CCCc2ccccc21)[C@@H]1CCCCN1C1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C23H25N3O3S/c27-23(24-19-12-7-9-16-8-1-2-10-17(16)19)20-13-5-6-15-26(20)22-18-11-3-4-14-21(18)30(28,29)25-22/h1-4,8,10-11,14,19-20H,5-7,9,12-13,15H2,(H,24,27)/t19-,20+/m1/s1 |
| InChIKey | MLRZZTFALPYLHL-UXHICEINSA-N |
| XLogP | 3.18 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |