C10H12Br4O3 — CID 85306590
(1,4,5,6-tetrabromo-7,7-dimethoxy-2-bicyclo[2.2.1]hept-5-enyl)methanol (PubChem CID 85306590) has the molecular formula C10H12Br4O3 and a molecular weight of 499.82 g/mol. Its IUPAC name is (1,4,5,6-tetrabromo-7,7-dimethoxy-2-bicyclo[2.2.1]hept-5-enyl)methanol.
| Compound Name | (1,4,5,6-tetrabromo-7,7-dimethoxy-2-bicyclo[2.2.1]hept-5-enyl)methanol |
|---|---|
| PubChem CID | 85306590 |
| Molecular Formula | C10H12Br4O3 |
| Molecular Weight | 499.82 g/mol |
| Exact Mass | 495.75 |
| IUPAC Name | (1,4,5,6-tetrabromo-7,7-dimethoxy-2-bicyclo[2.2.1]hept-5-enyl)methanol |
| SMILES | COC1(OC)C2(Br)CC(CO)C1(Br)C(Br)=C2Br |
| InChI | InChI=1S/C10H12Br4O3/c1-16-10(17-2)8(13)3-5(4-15)9(10,14)7(12)6(8)11/h5,15H,3-4H2,1-2H3 |
| InChIKey | VTSGQPKUVXERCM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.82 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|