About piperidine-1-carbodiselenoate;piperidin-1-ium
piperidine-1-carbodiselenoate;piperidin-1-ium (PubChem CID 85309427) has the molecular formula C11H22N2Se2
and a molecular weight of 340.23 g/mol. Its IUPAC name is piperidine-1-carbodiselenoate;piperidin-1-ium.
Molecular Properties
| Compound Name | piperidine-1-carbodiselenoate;piperidin-1-ium |
| PubChem CID | 85309427 |
| Molecular Formula | C11H22N2Se2 |
| Molecular Weight | 340.23 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | piperidine-1-carbodiselenoate;piperidin-1-ium |
| SMILES | C1CC[NH2+]CC1.[Se]=C([Se-])N1CCCCC1 |
| InChI | InChI=1S/C6H11NSe2.C5H11N/c8-6(9)7-4-2-1-3-5-7;1-2-4-6-5-3-1/h1-5H2,(H,8,9);6H,1-5H2 |
| InChIKey | BRKRCPJJIDGVCE-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 19.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.23 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze piperidine-1-carbodiselenoate;piperidin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidine-1-carbodiselenoate;piperidin-1-ium?
The IUPAC name of piperidine-1-carbodiselenoate;piperidin-1-ium (CID 85309427) is piperidine-1-carbodiselenoate;piperidin-1-ium.
What is the SMILES notation for piperidine-1-carbodiselenoate;piperidin-1-ium?
The canonical SMILES for piperidine-1-carbodiselenoate;piperidin-1-ium is C1CC[NH2+]CC1.[Se]=C([Se-])N1CCCCC1.
What is the InChIKey of piperidine-1-carbodiselenoate;piperidin-1-ium?
The InChIKey is BRKRCPJJIDGVCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NSe2.C5H11N/c8-6(9)7-4-2-1-3-5-7;1-2-4-6-5-3-1/h1-5H2,(H,8,9);6H,1-5H2.
What are the key properties of piperidine-1-carbodiselenoate;piperidin-1-ium?
piperidine-1-carbodiselenoate;piperidin-1-ium has a molecular weight of 340.23 g/mol, XLogP of -0.37, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for piperidine-1-carbodiselenoate;piperidin-1-ium is sourced from PubChem (CID 85309427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).