About 5-pyrrol-1-ylpentan-2-ol
5-pyrrol-1-ylpentan-2-ol (PubChem CID 85310978) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is 5-pyrrol-1-ylpentan-2-ol.
Molecular Properties
| Compound Name | 5-pyrrol-1-ylpentan-2-ol |
| PubChem CID | 85310978 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 5-pyrrol-1-ylpentan-2-ol |
| SMILES | CC(O)CCCn1cccc1 |
| InChI | InChI=1S/C9H15NO/c1-9(11)5-4-8-10-6-2-3-7-10/h2-3,6-7,9,11H,4-5,8H2,1H3 |
| InChIKey | QABCDTITCQHHKG-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-pyrrol-1-ylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyrrol-1-ylpentan-2-ol?
The IUPAC name of 5-pyrrol-1-ylpentan-2-ol (CID 85310978) is 5-pyrrol-1-ylpentan-2-ol.
What is the SMILES notation for 5-pyrrol-1-ylpentan-2-ol?
The canonical SMILES for 5-pyrrol-1-ylpentan-2-ol is CC(O)CCCn1cccc1.
What is the InChIKey of 5-pyrrol-1-ylpentan-2-ol?
The InChIKey is QABCDTITCQHHKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO/c1-9(11)5-4-8-10-6-2-3-7-10/h2-3,6-7,9,11H,4-5,8H2,1H3.
What are the key properties of 5-pyrrol-1-ylpentan-2-ol?
5-pyrrol-1-ylpentan-2-ol has a molecular weight of 153.22 g/mol, XLogP of 1.65, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyrrol-1-ylpentan-2-ol is sourced from PubChem (CID 85310978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).