C10H18N2O — CID 85312202
N-(1-methyl-2,3,4,4a,6,7,8,8a-octahydroquinolin-5-ylidene)hydroxylamine (PubChem CID 85312202) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is N-(1-methyl-2,3,4,4a,6,7,8,8a-octahydroquinolin-5-ylidene)hydroxylamine.
| Compound Name | N-(1-methyl-2,3,4,4a,6,7,8,8a-octahydroquinolin-5-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 85312202 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | N-(1-methyl-2,3,4,4a,6,7,8,8a-octahydroquinolin-5-ylidene)hydroxylamine |
| SMILES | CN1CCCC2C(=NO)CCCC21 |
| InChI | InChI=1S/C10H18N2O/c1-12-7-3-4-8-9(11-13)5-2-6-10(8)12/h8,10,13H,2-7H2,1H3 |
| InChIKey | MBNFLSNSHWCBIP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|