C10H12FN — CID 853158
(2S)-6-fluoro-2-methyl-1,2,3,4-tetrahydroquinoline (PubChem CID 853158) has the molecular formula C10H12FN and a molecular weight of 165.21 g/mol. Its IUPAC name is (2S)-6-fluoro-2-methyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | (2S)-6-fluoro-2-methyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 853158 |
| Molecular Formula | C10H12FN |
| Molecular Weight | 165.21 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | (2S)-6-fluoro-2-methyl-1,2,3,4-tetrahydroquinoline |
| SMILES | C[C@H]1CCc2cc(F)ccc2N1 |
| InChI | InChI=1S/C10H12FN/c1-7-2-3-8-6-9(11)4-5-10(8)12-7/h4-7,12H,2-3H2,1H3/t7-/m0/s1 |
| InChIKey | BDCCXYVTXRUGAN-ZETCQYMHSA-N |
| XLogP | 2.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.21 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |