About 3-tricyclo[3.1.0.02,6]hexanylmethanol
3-tricyclo[3.1.0.02,6]hexanylmethanol (PubChem CID 85316389) has the molecular formula C7H10O
and a molecular weight of 110.16 g/mol. Its IUPAC name is 3-tricyclo[3.1.0.02,6]hexanylmethanol.
Molecular Properties
| Compound Name | 3-tricyclo[3.1.0.02,6]hexanylmethanol |
| PubChem CID | 85316389 |
| Molecular Formula | C7H10O |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.07 |
| IUPAC Name | 3-tricyclo[3.1.0.02,6]hexanylmethanol |
| SMILES | OCC1CC2C3C1C23 |
| InChI | InChI=1S/C7H10O/c8-2-3-1-4-6-5(3)7(4)6/h3-8H,1-2H2 |
| InChIKey | XNNYUKDOCRXUSZ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-tricyclo[3.1.0.02,6]hexanylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tricyclo[3.1.0.02,6]hexanylmethanol?
The IUPAC name of 3-tricyclo[3.1.0.02,6]hexanylmethanol (CID 85316389) is 3-tricyclo[3.1.0.02,6]hexanylmethanol.
What is the SMILES notation for 3-tricyclo[3.1.0.02,6]hexanylmethanol?
The canonical SMILES for 3-tricyclo[3.1.0.02,6]hexanylmethanol is OCC1CC2C3C1C23.
What is the InChIKey of 3-tricyclo[3.1.0.02,6]hexanylmethanol?
The InChIKey is XNNYUKDOCRXUSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O/c8-2-3-1-4-6-5(3)7(4)6/h3-8H,1-2H2.
What are the key properties of 3-tricyclo[3.1.0.02,6]hexanylmethanol?
3-tricyclo[3.1.0.02,6]hexanylmethanol has a molecular weight of 110.16 g/mol, XLogP of 0.49, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tricyclo[3.1.0.02,6]hexanylmethanol is sourced from PubChem (CID 85316389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).