C17H17ClFNO2 — CID 8531985
4-chloro-N-[2-(2,4-dimethylphenoxy)ethyl]-2-fluorobenzamide (PubChem CID 8531985) has the molecular formula C17H17ClFNO2 and a molecular weight of 321.78 g/mol. Its IUPAC name is 4-chloro-N-[2-(2,4-dimethylphenoxy)ethyl]-2-fluorobenzamide.
| Compound Name | 4-chloro-N-[2-(2,4-dimethylphenoxy)ethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 8531985 |
| Molecular Formula | C17H17ClFNO2 |
| Molecular Weight | 321.78 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 4-chloro-N-[2-(2,4-dimethylphenoxy)ethyl]-2-fluorobenzamide |
| SMILES | Cc1ccc(OCCNC(=O)c2ccc(Cl)cc2F)c(C)c1 |
| InChI | InChI=1S/C17H17ClFNO2/c1-11-3-6-16(12(2)9-11)22-8-7-20-17(21)14-5-4-13(18)10-15(14)19/h3-6,9-10H,7-8H2,1-2H3,(H,20,21) |
| InChIKey | RCAIAGFQFFGWKN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.78 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|