C37H56O10 — CID 85320078
[2-hydroxy-3,8,8,17,19-pentamethyl-22-prop-1-en-2-yl-9-(3,4,5-trihydroxyoxan-2-yl)oxy-23,24-dioxaheptacyclo[19.2.1.01,18.03,17.04,14.07,12.012,14]tetracosan-16-yl] acetate (PubChem CID 85320078) has the molecular formula C37H56O10 and a molecular weight of 660.85 g/mol. Its IUPAC name is [2-hydroxy-3,8,8,17,19-pentamethyl-22-prop-1-en-2-yl-9-(3,4,5-trihydroxyoxan-2-yl)oxy-23,24-dioxaheptacyclo[19.2.1.01,18.03,17.04,14.07,12.012,14]tetracosan-16-yl] acetate.
| Compound Name | [2-hydroxy-3,8,8,17,19-pentamethyl-22-prop-1-en-2-yl-9-(3,4,5-trihydroxyoxan-2-yl)oxy-23,24-dioxaheptacyclo[19.2.1.01,18.03,17.04,14.07,12.012,14]tetracosan-16-yl] acetate |
|---|---|
| PubChem CID | 85320078 |
| Molecular Formula | C37H56O10 |
| Molecular Weight | 660.85 g/mol |
| Exact Mass | 660.39 |
| IUPAC Name | [2-hydroxy-3,8,8,17,19-pentamethyl-22-prop-1-en-2-yl-9-(3,4,5-trihydroxyoxan-2-yl)oxy-23,24-dioxaheptacyclo[19.2.1.01,18.03,17.04,14.07,12.012,14]tetracosan-16-yl] acetate |
| SMILES | C=C(C)C1OC23OC1CC(C)C2C1(C)C(OC(C)=O)CC24CC25CCC(OC2OCC(O)C(O)C2O)C(C)(C)C5CCC4C1(C)C3O |
| InChI | InChI=1S/C37H56O10/c1-17(2)28-21-13-18(3)29-34(8)25(44-19(4)38)14-36-16-35(36)12-11-24(45-30-27(41)26(40)20(39)15-43-30)32(5,6)22(35)9-10-23(36)33(34,7)31(42)37(29,46-21)47-28/h18,20-31,39-42H,1,9-16H2,2-8H3 |
| InChIKey | WUUHXBURWLJGRL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 144.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.85 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|